C26H20ClFN4O4S — CID 2410822
3-[2-amino-3-(4-chlorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]propyl 4-fluorobenzoate (PubChem CID 2410822) has the molecular formula C26H20ClFN4O4S and a molecular weight of 538.99 g/mol. Its IUPAC name is 3-[2-amino-3-(4-chlorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]propyl 4-fluorobenzoate.
| Compound Name | 3-[2-amino-3-(4-chlorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]propyl 4-fluorobenzoate |
|---|---|
| PubChem CID | 2410822 |
| Molecular Formula | C26H20ClFN4O4S |
| Molecular Weight | 538.99 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 3-[2-amino-3-(4-chlorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]propyl 4-fluorobenzoate |
| SMILES | Nc1c(S(=O)(=O)c2ccc(Cl)cc2)c2nc3ccccc3nc2n1CCCOC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H20ClFN4O4S/c27-17-8-12-19(13-9-17)37(34,35)23-22-25(31-21-5-2-1-4-20(21)30-22)32(24(23)29)14-3-15-36-26(33)16-6-10-18(28)11-7-16/h1-2,4-13H,3,14-15,29H2 |
| InChIKey | NPDYUCBUEQQWMY-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.99 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|