C22H30N4O2 — CID 4294624
heptyl 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 4294624) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is heptyl 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | heptyl 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 4294624 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | heptyl 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCCCCCCOC(=O)c1c(N)n(CCCC)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C22H30N4O2/c1-3-5-7-8-11-15-28-22(27)18-19-21(26(20(18)23)14-6-4-2)25-17-13-10-9-12-16(17)24-19/h9-10,12-13H,3-8,11,14-15,23H2,1-2H3 |
| InChIKey | VMZYKFJUVRUEGW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|