C21H26N4O3 — CID 3727119
oxolan-2-ylmethyl 2-amino-1-pentylpyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 3727119) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-amino-1-pentylpyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | oxolan-2-ylmethyl 2-amino-1-pentylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 3727119 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | oxolan-2-ylmethyl 2-amino-1-pentylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCCCCn1c(N)c(C(=O)OCC2CCCO2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C21H26N4O3/c1-2-3-6-11-25-19(22)17(21(26)28-13-14-8-7-12-27-14)18-20(25)24-16-10-5-4-9-15(16)23-18/h4-5,9-10,14H,2-3,6-8,11-13,22H2,1H3 |
| InChIKey | SBCQCGHJGQEQDQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|