C21H28N4O2 — CID 3721919
hexyl 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 3721919) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is hexyl 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | hexyl 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 3721919 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | hexyl 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCCCCCOC(=O)c1c(N)n(CCCC)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C21H28N4O2/c1-3-5-7-10-14-27-21(26)17-18-20(25(19(17)22)13-6-4-2)24-16-12-9-8-11-15(16)23-18/h8-9,11-12H,3-7,10,13-14,22H2,1-2H3 |
| InChIKey | XUDMCLSYYTYCJW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|