C19H24N4O3 — CID 2295570
butyl 2-amino-1-(3-methoxypropyl)pyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 2295570) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is butyl 2-amino-1-(3-methoxypropyl)pyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | butyl 2-amino-1-(3-methoxypropyl)pyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 2295570 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | butyl 2-amino-1-(3-methoxypropyl)pyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCCCOC(=O)c1c(N)n(CCCOC)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C19H24N4O3/c1-3-4-12-26-19(24)15-16-18(23(17(15)20)10-7-11-25-2)22-14-9-6-5-8-13(14)21-16/h5-6,8-9H,3-4,7,10-12,20H2,1-2H3 |
| InChIKey | JSCKAOWWTAHPJV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|