C21H28N4O3 — CID 2008652
[(2S)-butan-2-yl] 2-amino-1-(3-propan-2-yloxypropyl)pyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 2008652) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is [(2S)-butan-2-yl] 2-amino-1-(3-propan-2-yloxypropyl)pyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | [(2S)-butan-2-yl] 2-amino-1-(3-propan-2-yloxypropyl)pyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 2008652 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [(2S)-butan-2-yl] 2-amino-1-(3-propan-2-yloxypropyl)pyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CC[C@H](C)OC(=O)c1c(N)n(CCCOC(C)C)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C21H28N4O3/c1-5-14(4)28-21(26)17-18-20(24-16-10-7-6-9-15(16)23-18)25(19(17)22)11-8-12-27-13(2)3/h6-7,9-10,13-14H,5,8,11-12,22H2,1-4H3/t14-/m0/s1 |
| InChIKey | NPGUBLUPVIFTEZ-AWEZNQCLSA-N |
| XLogP | 3.94 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|