C25H18N6O8S — CID 4919795
2-[2-amino-3-(benzenesulfonyl)pyrrolo[3,2-b]quinoxalin-1-yl]ethyl 3,5-dinitrobenzoate (PubChem CID 4919795) has the molecular formula C25H18N6O8S and a molecular weight of 562.52 g/mol. Its IUPAC name is 2-[2-amino-3-(benzenesulfonyl)pyrrolo[3,2-b]quinoxalin-1-yl]ethyl 3,5-dinitrobenzoate.
| Compound Name | 2-[2-amino-3-(benzenesulfonyl)pyrrolo[3,2-b]quinoxalin-1-yl]ethyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 4919795 |
| Molecular Formula | C25H18N6O8S |
| Molecular Weight | 562.52 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | 2-[2-amino-3-(benzenesulfonyl)pyrrolo[3,2-b]quinoxalin-1-yl]ethyl 3,5-dinitrobenzoate |
| SMILES | Nc1c(S(=O)(=O)c2ccccc2)c2nc3ccccc3nc2n1CCOC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H18N6O8S/c26-23-22(40(37,38)18-6-2-1-3-7-18)21-24(28-20-9-5-4-8-19(20)27-21)29(23)10-11-39-25(32)15-12-16(30(33)34)14-17(13-15)31(35)36/h1-9,12-14H,10-11,26H2 |
| InChIKey | AMFHLOLRGDYXLO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 203.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|