C26H20N6O8S — CID 2307717
2-[2-amino-3-(4-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]ethyl 3,5-dinitrobenzoate (PubChem CID 2307717) has the molecular formula C26H20N6O8S and a molecular weight of 576.55 g/mol. Its IUPAC name is 2-[2-amino-3-(4-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]ethyl 3,5-dinitrobenzoate.
| Compound Name | 2-[2-amino-3-(4-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]ethyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 2307717 |
| Molecular Formula | C26H20N6O8S |
| Molecular Weight | 576.55 g/mol |
| Exact Mass | 576.11 |
| IUPAC Name | 2-[2-amino-3-(4-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-1-yl]ethyl 3,5-dinitrobenzoate |
| SMILES | Cc1ccc(S(=O)(=O)c2c(N)n(CCOC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c3nc4ccccc4nc23)cc1 |
| InChI | InChI=1S/C26H20N6O8S/c1-15-6-8-19(9-7-15)41(38,39)23-22-25(29-21-5-3-2-4-20(21)28-22)30(24(23)27)10-11-40-26(33)16-12-17(31(34)35)14-18(13-16)32(36)37/h2-9,12-14H,10-11,27H2,1H3 |
| InChIKey | HOMVKENBBQXQOI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 203.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|