C32H32N6O7S — CID 3627976
N-[3-(4-methylphenyl)sulfonyl-1-octan-3-ylpyrrolo[3,2-b]quinoxalin-2-yl]-3,5-dinitrobenzamide (PubChem CID 3627976) has the molecular formula C32H32N6O7S and a molecular weight of 644.71 g/mol. Its IUPAC name is N-[3-(4-methylphenyl)sulfonyl-1-octan-3-ylpyrrolo[3,2-b]quinoxalin-2-yl]-3,5-dinitrobenzamide.
| Compound Name | N-[3-(4-methylphenyl)sulfonyl-1-octan-3-ylpyrrolo[3,2-b]quinoxalin-2-yl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3627976 |
| Molecular Formula | C32H32N6O7S |
| Molecular Weight | 644.71 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | N-[3-(4-methylphenyl)sulfonyl-1-octan-3-ylpyrrolo[3,2-b]quinoxalin-2-yl]-3,5-dinitrobenzamide |
| SMILES | CCCCCC(CC)n1c(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c(S(=O)(=O)c2ccc(C)cc2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C32H32N6O7S/c1-4-6-7-10-22(5-2)36-30-28(33-26-11-8-9-12-27(26)34-30)29(46(44,45)25-15-13-20(3)14-16-25)31(36)35-32(39)21-17-23(37(40)41)19-24(18-21)38(42)43/h8-9,11-19,22H,4-7,10H2,1-3H3,(H,35,39) |
| InChIKey | SAOYLUCQYYLFBQ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 180.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.71 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|