C33H25N5O5S — CID 98387622
(Z)-N-[3-(benzenesulfonyl)-1-[(1S)-1-phenylethyl]pyrrolo[3,2-b]quinoxalin-2-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 98387622) has the molecular formula C33H25N5O5S and a molecular weight of 603.66 g/mol. Its IUPAC name is (Z)-N-[3-(benzenesulfonyl)-1-[(1S)-1-phenylethyl]pyrrolo[3,2-b]quinoxalin-2-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-N-[3-(benzenesulfonyl)-1-[(1S)-1-phenylethyl]pyrrolo[3,2-b]quinoxalin-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 98387622 |
| Molecular Formula | C33H25N5O5S |
| Molecular Weight | 603.66 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | (Z)-N-[3-(benzenesulfonyl)-1-[(1S)-1-phenylethyl]pyrrolo[3,2-b]quinoxalin-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | C[C@@H](c1ccccc1)n1c(NC(=O)/C=C\c2cccc([N+](=O)[O-])c2)c(S(=O)(=O)c2ccccc2)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C33H25N5O5S/c1-22(24-12-4-2-5-13-24)37-32-30(34-27-17-8-9-18-28(27)35-32)31(44(42,43)26-15-6-3-7-16-26)33(37)36-29(39)20-19-23-11-10-14-25(21-23)38(40)41/h2-22H,1H3,(H,36,39)/b20-19-/t22-/m0/s1 |
| InChIKey | FHRWEQUSBUPGBF-SQJPUDIVSA-N |
| XLogP | 6.59 |
| TPSA | 137.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.66 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|