C29H23N5O5 — CID 3726757
ethyl 1-benzyl-2-[3-(3-nitrophenyl)prop-2-enoylamino]pyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 3726757) has the molecular formula C29H23N5O5 and a molecular weight of 521.53 g/mol. Its IUPAC name is ethyl 1-benzyl-2-[3-(3-nitrophenyl)prop-2-enoylamino]pyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | ethyl 1-benzyl-2-[3-(3-nitrophenyl)prop-2-enoylamino]pyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 3726757 |
| Molecular Formula | C29H23N5O5 |
| Molecular Weight | 521.53 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | ethyl 1-benzyl-2-[3-(3-nitrophenyl)prop-2-enoylamino]pyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C=Cc2cccc([N+](=O)[O-])c2)n(Cc2ccccc2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C29H23N5O5/c1-2-39-29(36)25-26-28(31-23-14-7-6-13-22(23)30-26)33(18-20-9-4-3-5-10-20)27(25)32-24(35)16-15-19-11-8-12-21(17-19)34(37)38/h3-17H,2,18H2,1H3,(H,32,35) |
| InChIKey | FGKCEQYCSRVBAQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|