C25H16N6O3 — CID 4963098
N-(1-benzyl-3-cyanopyrrolo[3,2-b]quinoxalin-2-yl)-3-nitrobenzamide (PubChem CID 4963098) has the molecular formula C25H16N6O3 and a molecular weight of 448.44 g/mol. Its IUPAC name is N-(1-benzyl-3-cyanopyrrolo[3,2-b]quinoxalin-2-yl)-3-nitrobenzamide.
| Compound Name | N-(1-benzyl-3-cyanopyrrolo[3,2-b]quinoxalin-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 4963098 |
| Molecular Formula | C25H16N6O3 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | N-(1-benzyl-3-cyanopyrrolo[3,2-b]quinoxalin-2-yl)-3-nitrobenzamide |
| SMILES | N#Cc1c(NC(=O)c2cccc([N+](=O)[O-])c2)n(Cc2ccccc2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C25H16N6O3/c26-14-19-22-24(28-21-12-5-4-11-20(21)27-22)30(15-16-7-2-1-3-8-16)23(19)29-25(32)17-9-6-10-18(13-17)31(33)34/h1-13H,15H2,(H,29,32) |
| InChIKey | IDUPCCHANVPSCC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|