C20H18N4O3S — CID 26841223
N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-nitrobenzamide (PubChem CID 26841223) has the molecular formula C20H18N4O3S and a molecular weight of 394.46 g/mol. Its IUPAC name is N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-nitrobenzamide.
| Compound Name | N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 26841223 |
| Molecular Formula | C20H18N4O3S |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-nitrobenzamide |
| SMILES | O=C(Nc1nc2c(s1)CN(Cc1ccccc1)CC2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H18N4O3S/c25-19(15-7-4-8-16(11-15)24(26)27)22-20-21-17-9-10-23(13-18(17)28-20)12-14-5-2-1-3-6-14/h1-8,11H,9-10,12-13H2,(H,21,22,25) |
| InChIKey | DFUDMQHNSJHZKG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|