C23H19N5O3S — CID 1187624
N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-cyano-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 1187624) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-cyano-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-cyano-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1187624 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-cyano-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#CC(=Cc1cccc([N+](=O)[O-])c1)C(=O)Nc1nc2c(s1)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C23H19N5O3S/c24-13-18(11-17-7-4-8-19(12-17)28(30)31)22(29)26-23-25-20-9-10-27(15-21(20)32-23)14-16-5-2-1-3-6-16/h1-8,11-12H,9-10,14-15H2,(H,25,26,29) |
| InChIKey | NPPIZXFUOIZCBZ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|