C23H18Cl2N4OS — CID 1187623
(E)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 1187623) has the molecular formula C23H18Cl2N4OS and a molecular weight of 469.40 g/mol. Its IUPAC name is (E)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1187623 |
| Molecular Formula | C23H18Cl2N4OS |
| Molecular Weight | 469.40 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | (E)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-2-cyano-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(Cl)cc1Cl)C(=O)Nc1nc2c(s1)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C23H18Cl2N4OS/c24-18-7-6-16(19(25)11-18)10-17(12-26)22(30)28-23-27-20-8-9-29(14-21(20)31-23)13-15-4-2-1-3-5-15/h1-7,10-11H,8-9,13-14H2,(H,27,28,30)/b17-10+ |
| InChIKey | RDAXGIRAUQZYHU-LICLKQGHSA-N |
| XLogP | 5.55 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.40 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|