C21H27N5OS — CID 78772891
(Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)prop-2-enamide (PubChem CID 78772891) has the molecular formula C21H27N5OS and a molecular weight of 397.55 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 78772891 |
| Molecular Formula | C21H27N5OS |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (Z)-2-cyano-3-(2,5-dimethyl-1-propylpyrrol-3-yl)-N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)prop-2-enamide |
| SMILES | CCCn1c(C)cc(/C=C(/C#N)C(=O)Nc2nc3c(s2)CN(CC)CC3)c1C |
| InChI | InChI=1S/C21H27N5OS/c1-5-8-26-14(3)10-16(15(26)4)11-17(12-22)20(27)24-21-23-18-7-9-25(6-2)13-19(18)28-21/h10-11H,5-9,13H2,1-4H3,(H,23,24,27)/b17-11- |
| InChIKey | OYITVMTXVHMXHT-BOPFTXTBSA-N |
| XLogP | 3.90 |
| TPSA | 73.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|