C21H18N4OS2 — CID 2327791
(Z)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-cyano-3-thiophen-2-ylprop-2-enamide (PubChem CID 2327791) has the molecular formula C21H18N4OS2 and a molecular weight of 406.54 g/mol. Its IUPAC name is (Z)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-cyano-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (Z)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-cyano-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 2327791 |
| Molecular Formula | C21H18N4OS2 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | (Z)-N-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-cyano-3-thiophen-2-ylprop-2-enamide |
| SMILES | N#C/C(=C/c1cccs1)C(=O)Nc1nc2c(s1)CCN(Cc1ccccc1)C2 |
| InChI | InChI=1S/C21H18N4OS2/c22-12-16(11-17-7-4-10-27-17)20(26)24-21-23-18-14-25(9-8-19(18)28-21)13-15-5-2-1-3-6-15/h1-7,10-11H,8-9,13-14H2,(H,23,24,26)/b16-11- |
| InChIKey | NBDCHZXAIUXQKX-WJDWOHSUSA-N |
| XLogP | 4.31 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|