C20H18ClFN4S2 — CID 21008661
1-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(3-chloro-4-fluorophenyl)thiourea (PubChem CID 21008661) has the molecular formula C20H18ClFN4S2 and a molecular weight of 432.98 g/mol. Its IUPAC name is 1-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(3-chloro-4-fluorophenyl)thiourea.
| Compound Name | 1-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(3-chloro-4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 21008661 |
| Molecular Formula | C20H18ClFN4S2 |
| Molecular Weight | 432.98 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | 1-(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-(3-chloro-4-fluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2nc3c(s2)CN(Cc2ccccc2)CC3)cc1Cl |
| InChI | InChI=1S/C20H18ClFN4S2/c21-15-10-14(6-7-16(15)22)23-19(27)25-20-24-17-8-9-26(12-18(17)28-20)11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H2,23,24,25,27) |
| InChIKey | KSKHNTVTWTYDOQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.98 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|