C15H17ClN4O3S — CID 18567123
N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-nitrobenzamide;hydrochloride (PubChem CID 18567123) has the molecular formula C15H17ClN4O3S and a molecular weight of 368.85 g/mol. Its IUPAC name is N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-nitrobenzamide;hydrochloride.
| Compound Name | N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 18567123 |
| Molecular Formula | C15H17ClN4O3S |
| Molecular Weight | 368.85 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-(5-ethyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)-3-nitrobenzamide;hydrochloride |
| SMILES | CCN1CCc2nc(NC(=O)c3cccc([N+](=O)[O-])c3)sc2C1.Cl |
| InChI | InChI=1S/C15H16N4O3S.ClH/c1-2-18-7-6-12-13(9-18)23-15(16-12)17-14(20)10-4-3-5-11(8-10)19(21)22;/h3-5,8H,2,6-7,9H2,1H3,(H,16,17,20);1H |
| InChIKey | ONWFZVCPYXSSSV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.85 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|