C23H23N5O4S — CID 112794436
N-[1-[(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 112794436) has the molecular formula C23H23N5O4S and a molecular weight of 465.54 g/mol. Its IUPAC name is N-[1-[(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-[(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 112794436 |
| Molecular Formula | C23H23N5O4S |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | N-[1-[(5-benzyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl)amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | CC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)Nc1nc2c(s1)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C23H23N5O4S/c1-15(24-22(30)17-8-5-9-18(12-17)28(31)32)21(29)26-23-25-19-10-11-27(14-20(19)33-23)13-16-6-3-2-4-7-16/h2-9,12,15H,10-11,13-14H2,1H3,(H,24,30)(H,25,26,29) |
| InChIKey | FKTSPUCSPQSFMR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|