C23H20N6O3 — CID 2377801
N-(3-cyano-1-pentylpyrrolo[3,2-b]quinoxalin-2-yl)-3-nitrobenzamide (PubChem CID 2377801) has the molecular formula C23H20N6O3 and a molecular weight of 428.45 g/mol. Its IUPAC name is N-(3-cyano-1-pentylpyrrolo[3,2-b]quinoxalin-2-yl)-3-nitrobenzamide.
| Compound Name | N-(3-cyano-1-pentylpyrrolo[3,2-b]quinoxalin-2-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 2377801 |
| Molecular Formula | C23H20N6O3 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-(3-cyano-1-pentylpyrrolo[3,2-b]quinoxalin-2-yl)-3-nitrobenzamide |
| SMILES | CCCCCn1c(NC(=O)c2cccc([N+](=O)[O-])c2)c(C#N)c2nc3ccccc3nc21 |
| InChI | InChI=1S/C23H20N6O3/c1-2-3-6-12-28-21(27-23(30)15-8-7-9-16(13-15)29(31)32)17(14-24)20-22(28)26-19-11-5-4-10-18(19)25-20/h4-5,7-11,13H,2-3,6,12H2,1H3,(H,27,30) |
| InChIKey | CFLMBEPXXMAMDN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|