C31H27N5O5 — CID 3524707
pentyl 2-[3-(3-nitrophenyl)prop-2-enoylamino]-1-phenylpyrrolo[3,2-b]quinoxaline-3-carboxylate (PubChem CID 3524707) has the molecular formula C31H27N5O5 and a molecular weight of 549.59 g/mol. Its IUPAC name is pentyl 2-[3-(3-nitrophenyl)prop-2-enoylamino]-1-phenylpyrrolo[3,2-b]quinoxaline-3-carboxylate.
| Compound Name | pentyl 2-[3-(3-nitrophenyl)prop-2-enoylamino]-1-phenylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
|---|---|
| PubChem CID | 3524707 |
| Molecular Formula | C31H27N5O5 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | pentyl 2-[3-(3-nitrophenyl)prop-2-enoylamino]-1-phenylpyrrolo[3,2-b]quinoxaline-3-carboxylate |
| SMILES | CCCCCOC(=O)c1c(NC(=O)C=Cc2cccc([N+](=O)[O-])c2)n(-c2ccccc2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C31H27N5O5/c1-2-3-9-19-41-31(38)27-28-30(33-25-16-8-7-15-24(25)32-28)35(22-12-5-4-6-13-22)29(27)34-26(37)18-17-21-11-10-14-23(20-21)36(39)40/h4-8,10-18,20H,2-3,9,19H2,1H3,(H,34,37) |
| InChIKey | PWKBUEUHKGCCSO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 129.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|