C33H26N4O3S — CID 2067277
(E)-N-[1-benzyl-3-(4-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide (PubChem CID 2067277) has the molecular formula C33H26N4O3S and a molecular weight of 558.66 g/mol. Its IUPAC name is (E)-N-[1-benzyl-3-(4-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-benzyl-3-(4-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2067277 |
| Molecular Formula | C33H26N4O3S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | (E)-N-[1-benzyl-3-(4-methylphenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(S(=O)(=O)c2c(NC(=O)/C=C/c3ccccc3)n(Cc3ccccc3)c3nc4ccccc4nc23)cc1 |
| InChI | InChI=1S/C33H26N4O3S/c1-23-16-19-26(20-17-23)41(39,40)31-30-32(35-28-15-9-8-14-27(28)34-30)37(22-25-12-6-3-7-13-25)33(31)36-29(38)21-18-24-10-4-2-5-11-24/h2-21H,22H2,1H3,(H,36,38)/b21-18+ |
| InChIKey | XFGNNFGFYOZQGQ-DYTRJAOYSA-N |
| XLogP | 6.43 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|