C27H19N5O — CID 3787991
N-[3-cyano-1-(4-methylphenyl)pyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide (PubChem CID 3787991) has the molecular formula C27H19N5O and a molecular weight of 429.48 g/mol. Its IUPAC name is N-[3-cyano-1-(4-methylphenyl)pyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[3-cyano-1-(4-methylphenyl)pyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3787991 |
| Molecular Formula | C27H19N5O |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | N-[3-cyano-1-(4-methylphenyl)pyrrolo[3,2-b]quinoxalin-2-yl]-3-phenylprop-2-enamide |
| SMILES | Cc1ccc(-n2c(NC(=O)C=Cc3ccccc3)c(C#N)c3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C27H19N5O/c1-18-11-14-20(15-12-18)32-26(31-24(33)16-13-19-7-3-2-4-8-19)21(17-28)25-27(32)30-23-10-6-5-9-22(23)29-25/h2-16H,1H3,(H,31,33) |
| InChIKey | VDBKQFZDVAWQSD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|