C22H15N5 — CID 2310656
1-(4-methylphenyl)-2-pyrrol-1-ylpyrrolo[3,2-b]quinoxaline-3-carbonitrile (PubChem CID 2310656) has the molecular formula C22H15N5 and a molecular weight of 349.40 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-pyrrol-1-ylpyrrolo[3,2-b]quinoxaline-3-carbonitrile.
| Compound Name | 1-(4-methylphenyl)-2-pyrrol-1-ylpyrrolo[3,2-b]quinoxaline-3-carbonitrile |
|---|---|
| PubChem CID | 2310656 |
| Molecular Formula | C22H15N5 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 1-(4-methylphenyl)-2-pyrrol-1-ylpyrrolo[3,2-b]quinoxaline-3-carbonitrile |
| SMILES | Cc1ccc(-n2c(-n3cccc3)c(C#N)c3nc4ccccc4nc32)cc1 |
| InChI | InChI=1S/C22H15N5/c1-15-8-10-16(11-9-15)27-21-20(24-18-6-2-3-7-19(18)25-21)17(14-23)22(27)26-12-4-5-13-26/h2-13H,1H3 |
| InChIKey | RMRHITZIVAQNEJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_F(5)', 'substructure': 'N/A'} |
|---|