C17H17N5 — CID 657501
2-amino-1-cyclohexylpyrrolo[3,2-b]quinoxaline-3-carbonitrile (PubChem CID 657501) has the molecular formula C17H17N5 and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-amino-1-cyclohexylpyrrolo[3,2-b]quinoxaline-3-carbonitrile.
| Compound Name | 2-amino-1-cyclohexylpyrrolo[3,2-b]quinoxaline-3-carbonitrile |
|---|---|
| PubChem CID | 657501 |
| Molecular Formula | C17H17N5 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-amino-1-cyclohexylpyrrolo[3,2-b]quinoxaline-3-carbonitrile |
| SMILES | N#Cc1c(N)n(C2CCCCC2)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C17H17N5/c18-10-12-15-17(21-14-9-5-4-8-13(14)20-15)22(16(12)19)11-6-2-1-3-7-11/h4-5,8-9,11H,1-3,6-7,19H2 |
| InChIKey | BTXXNGUZHZKTAY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |