About 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile
1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile (PubChem CID 933055) has the molecular formula C11H8N6
and a molecular weight of 224.23 g/mol. Its IUPAC name is 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile.
Molecular Properties
| Compound Name | 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile |
| PubChem CID | 933055 |
| Molecular Formula | C11H8N6 |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile |
| SMILES | N#Cc1c(N)n(N)c2nc3ccccc3nc12 |
| InChI | InChI=1S/C11H8N6/c12-5-6-9-11(17(14)10(6)13)16-8-4-2-1-3-7(8)15-9/h1-4H,13-14H2 |
| InChIKey | OUOYFZIIKUVTQG-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile?
The IUPAC name of 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile (CID 933055) is 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile.
What is the SMILES notation for 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile?
The canonical SMILES for 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile is N#Cc1c(N)n(N)c2nc3ccccc3nc12.
What is the InChIKey of 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile?
The InChIKey is OUOYFZIIKUVTQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N6/c12-5-6-9-11(17(14)10(6)13)16-8-4-2-1-3-7(8)15-9/h1-4H,13-14H2.
What are the key properties of 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile?
1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile has a molecular weight of 224.23 g/mol, XLogP of 0.75, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diaminopyrrolo[3,2-b]quinoxaline-3-carbonitrile is sourced from PubChem (CID 933055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).