C22H21FN4O2S — CID 2012095
1-cyclohexyl-3-(4-fluorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-amine (PubChem CID 2012095) has the molecular formula C22H21FN4O2S and a molecular weight of 424.50 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-fluorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-amine.
| Compound Name | 1-cyclohexyl-3-(4-fluorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-amine |
|---|---|
| PubChem CID | 2012095 |
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 1-cyclohexyl-3-(4-fluorophenyl)sulfonylpyrrolo[3,2-b]quinoxalin-2-amine |
| SMILES | Nc1c(S(=O)(=O)c2ccc(F)cc2)c2nc3ccccc3nc2n1C1CCCCC1 |
| InChI | InChI=1S/C22H21FN4O2S/c23-14-10-12-16(13-11-14)30(28,29)20-19-22(26-18-9-5-4-8-17(18)25-19)27(21(20)24)15-6-2-1-3-7-15/h4-5,8-13,15H,1-3,6-7,24H2 |
| InChIKey | LYOOPHMICZLNSL-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |