C22H17N5O — CID 659460
17-(4-methylphenyl)-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 659460) has the molecular formula C22H17N5O and a molecular weight of 367.41 g/mol. Its IUPAC name is 17-(4-methylphenyl)-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 17-(4-methylphenyl)-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 659460 |
| Molecular Formula | C22H17N5O |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 17-(4-methylphenyl)-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | C=CCn1cnc2c(c1=O)c1nc3ccccc3nc1n2-c1ccc(C)cc1 |
| InChI | InChI=1S/C22H17N5O/c1-3-12-26-13-23-20-18(22(26)28)19-21(25-17-7-5-4-6-16(17)24-19)27(20)15-10-8-14(2)9-11-15/h3-11,13H,1,12H2,2H3 |
| InChIKey | KQOCUCRZMGMBNB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|