C25H22N6O4 — CID 664399
13-prop-2-enyl-17-[(3,4,5-trimethoxyphenyl)methylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one (PubChem CID 664399) has the molecular formula C25H22N6O4 and a molecular weight of 470.49 g/mol. Its IUPAC name is 13-prop-2-enyl-17-[(3,4,5-trimethoxyphenyl)methylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one.
| Compound Name | 13-prop-2-enyl-17-[(3,4,5-trimethoxyphenyl)methylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
|---|---|
| PubChem CID | 664399 |
| Molecular Formula | C25H22N6O4 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 13-prop-2-enyl-17-[(3,4,5-trimethoxyphenyl)methylideneamino]-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-12-one |
| SMILES | C=CCn1cnc2c(c1=O)c1nc3ccccc3nc1n2N=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C25H22N6O4/c1-5-10-30-14-26-23-20(25(30)32)21-24(29-17-9-7-6-8-16(17)28-21)31(23)27-13-15-11-18(33-2)22(35-4)19(12-15)34-3/h5-9,11-14H,1,10H2,2-4H3 |
| InChIKey | PHFMLTDKCKVKPG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 105.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|