C24H21N6O3+ — CID 135402474
17-[(2,3-dimethoxyphenyl)methylideneamino]-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one (PubChem CID 135402474) has the molecular formula C24H21N6O3+ and a molecular weight of 441.47 g/mol. Its IUPAC name is 17-[(2,3-dimethoxyphenyl)methylideneamino]-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one.
| Compound Name | 17-[(2,3-dimethoxyphenyl)methylideneamino]-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
|---|---|
| PubChem CID | 135402474 |
| Molecular Formula | C24H21N6O3+ |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 17-[(2,3-dimethoxyphenyl)methylideneamino]-13-prop-2-enyl-2,9,13,15,17-pentazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),14-heptaen-15-ium-12-one |
| SMILES | C=CCn1c[nH+]c2c(c1=O)c1nc3ccccc3nc1n2N=Cc1cccc(OC)c1OC |
| InChI | InChI=1S/C24H20N6O3/c1-4-12-29-14-25-22-19(24(29)31)20-23(28-17-10-6-5-9-16(17)27-20)30(22)26-13-15-8-7-11-18(32-2)21(15)33-3/h4-11,13-14H,1,12H2,2-3H3/p+1 |
| InChIKey | LXWWIOMXNQNSFF-UHFFFAOYSA-O |
| XLogP | 2.80 |
| TPSA | 97.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|