C16H16N4O2 — CID 6858637
1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]benzimidazol-2-amine (PubChem CID 6858637) has the molecular formula C16H16N4O2 and a molecular weight of 296.33 g/mol. Its IUPAC name is 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]benzimidazol-2-amine.
| Compound Name | 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]benzimidazol-2-amine |
|---|---|
| PubChem CID | 6858637 |
| Molecular Formula | C16H16N4O2 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-[(E)-(2,3-dimethoxyphenyl)methylideneamino]benzimidazol-2-amine |
| SMILES | COc1cccc(/C=N/n2c(N)nc3ccccc32)c1OC |
| InChI | InChI=1S/C16H16N4O2/c1-21-14-9-5-6-11(15(14)22-2)10-18-20-13-8-4-3-7-12(13)19-16(20)17/h3-10H,1-2H3,(H2,17,19)/b18-10+ |
| InChIKey | YYALGRBIWHKNEH-VCHYOVAHSA-N |
| XLogP | 2.52 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|