C15H17N3O3 — CID 9024279
6-amino-1-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-4-methylpyridin-2-one (PubChem CID 9024279) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is 6-amino-1-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-4-methylpyridin-2-one.
| Compound Name | 6-amino-1-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-4-methylpyridin-2-one |
|---|---|
| PubChem CID | 9024279 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 6-amino-1-[(Z)-(2,3-dimethoxyphenyl)methylideneamino]-4-methylpyridin-2-one |
| SMILES | COc1cccc(/C=N\n2c(N)cc(C)cc2=O)c1OC |
| InChI | InChI=1S/C15H17N3O3/c1-10-7-13(16)18(14(19)8-10)17-9-11-5-4-6-12(20-2)15(11)21-3/h4-9H,16H2,1-3H3/b17-9- |
| InChIKey | FSNQEIGWJUATAF-MFOYZWKCSA-N |
| XLogP | 1.64 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|