C14H13N4O5- — CID 9024841
4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]-2-methoxy-6-nitrophenolate (PubChem CID 9024841) has the molecular formula C14H13N4O5- and a molecular weight of 317.28 g/mol. Its IUPAC name is 4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 9024841 |
| Molecular Formula | C14H13N4O5- |
| Molecular Weight | 317.28 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 4-[(Z)-(2-amino-4-methyl-6-oxo-1-pyridinyl)iminomethyl]-2-methoxy-6-nitrophenolate |
| SMILES | COc1cc(/C=N\n2c(N)cc(C)cc2=O)cc([N+](=O)[O-])c1[O-] |
| InChI | InChI=1S/C14H14N4O5/c1-8-3-12(15)17(13(19)4-8)16-7-9-5-10(18(21)22)14(20)11(6-9)23-2/h3-7,20H,15H2,1-2H3/p-1/b16-7- |
| InChIKey | BNXFVTDQVZMTJR-APSNUPSMSA-M |
| XLogP | 0.61 |
| TPSA | 135.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|