C11H12N3O6- — CID 6894052
4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate (PubChem CID 6894052) has the molecular formula C11H12N3O6- and a molecular weight of 282.23 g/mol. Its IUPAC name is 4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 6894052 |
| Molecular Formula | C11H12N3O6- |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]-2-methoxy-6-nitrophenolate |
| SMILES | CCOC(=O)N/N=C/c1cc(OC)c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13N3O6/c1-3-20-11(16)13-12-6-7-4-8(14(17)18)10(15)9(5-7)19-2/h4-6,15H,3H2,1-2H3,(H,13,16)/p-1/b12-6+ |
| InChIKey | GKJLLZVHSDUWFP-WUXMJOGZSA-M |
| XLogP | 0.76 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|