C18H19N3O8S — CID 6908536
[4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 6908536) has the molecular formula C18H19N3O8S and a molecular weight of 437.43 g/mol. Its IUPAC name is [4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 6908536 |
| Molecular Formula | C18H19N3O8S |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | [4-[(E)-(ethoxycarbonylhydrazinylidene)methyl]-2-methoxyphenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | CCOC(=O)N/N=C/c1ccc(OS(=O)(=O)c2ccc(C)c([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C18H19N3O8S/c1-4-28-18(22)20-19-11-13-6-8-16(17(9-13)27-3)29-30(25,26)14-7-5-12(2)15(10-14)21(23)24/h5-11H,4H2,1-3H3,(H,20,22)/b19-11+ |
| InChIKey | BCWQWZINAXZFMV-YBFXNURJSA-N |
| XLogP | 2.76 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|