C16H17N3O4S2 — CID 6872606
[5-[(E)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 6872606) has the molecular formula C16H17N3O4S2 and a molecular weight of 379.46 g/mol. Its IUPAC name is [5-[(E)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [5-[(E)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 6872606 |
| Molecular Formula | C16H17N3O4S2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | [5-[(E)-(carbamothioylhydrazinylidene)methyl]-2-methoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(/C=N/NC(N)=S)cc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H17N3O4S2/c1-11-3-6-13(7-4-11)25(20,21)23-15-9-12(5-8-14(15)22-2)10-18-19-16(17)24/h3-10H,1-2H3,(H3,17,19,24)/b18-10+ |
| InChIKey | LPXGGROUDYSVEF-VCHYOVAHSA-N |
| XLogP | 1.94 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|