C9H11N3O4S2 — CID 5035221
5-[(carbamothioylhydrazinylidene)methyl]-2-methoxybenzenesulfonic acid (PubChem CID 5035221) has the molecular formula C9H11N3O4S2 and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-[(carbamothioylhydrazinylidene)methyl]-2-methoxybenzenesulfonic acid.
| Compound Name | 5-[(carbamothioylhydrazinylidene)methyl]-2-methoxybenzenesulfonic acid |
|---|---|
| PubChem CID | 5035221 |
| Molecular Formula | C9H11N3O4S2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 5-[(carbamothioylhydrazinylidene)methyl]-2-methoxybenzenesulfonic acid |
| SMILES | COc1ccc(C=NNC(N)=S)cc1S(=O)(=O)O |
| InChI | InChI=1S/C9H11N3O4S2/c1-16-7-3-2-6(5-11-12-9(10)17)4-8(7)18(13,14)15/h2-5H,1H3,(H3,10,12,17)(H,13,14,15) |
| InChIKey | AMVHHRPVVFXEPE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|