C9H13ClN4O4S — CID 54601430
5-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxybenzenesulfonic acid;hydrochloride (PubChem CID 54601430) has the molecular formula C9H13ClN4O4S and a molecular weight of 308.75 g/mol. Its IUPAC name is 5-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxybenzenesulfonic acid;hydrochloride.
| Compound Name | 5-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxybenzenesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 54601430 |
| Molecular Formula | C9H13ClN4O4S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 5-[(E)-(diaminomethylidenehydrazinylidene)methyl]-2-methoxybenzenesulfonic acid;hydrochloride |
| SMILES | COc1ccc(/C=N/N=C(N)N)cc1S(=O)(=O)O.Cl |
| InChI | InChI=1S/C9H12N4O4S.ClH/c1-17-7-3-2-6(5-12-13-9(10)11)4-8(7)18(14,15)16;/h2-5H,1H3,(H4,10,11,13)(H,14,15,16);1H/b12-5+; |
| InChIKey | XEDKOJFUXXINGW-NKPNRJPBSA-N |
| XLogP | -0.03 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|