C18H18N4NaO10S2+ — CID 54605292
sodium 2-methoxy-5-[(E)-[[2-[(2E)-2-[(4-methoxy-3-sulfophenyl)methylidene]hydrazinyl]-2-oxoacetyl]hydrazinylidene]methyl]benzenesulfonic acid (PubChem CID 54605292) has the molecular formula C18H18N4NaO10S2+ and a molecular weight of 537.48 g/mol. Its IUPAC name is sodium 2-methoxy-5-[(E)-[[2-[(2E)-2-[(4-methoxy-3-sulfophenyl)methylidene]hydrazinyl]-2-oxoacetyl]hydrazinylidene]methyl]benzenesulfonic acid.
| Compound Name | sodium 2-methoxy-5-[(E)-[[2-[(2E)-2-[(4-methoxy-3-sulfophenyl)methylidene]hydrazinyl]-2-oxoacetyl]hydrazinylidene]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 54605292 |
| Molecular Formula | C18H18N4NaO10S2+ |
| Molecular Weight | 537.48 g/mol |
| Exact Mass | 537.04 |
| IUPAC Name | sodium 2-methoxy-5-[(E)-[[2-[(2E)-2-[(4-methoxy-3-sulfophenyl)methylidene]hydrazinyl]-2-oxoacetyl]hydrazinylidene]methyl]benzenesulfonic acid |
| SMILES | COc1ccc(/C=N/NC(=O)C(=O)N/N=C/c2ccc(OC)c(S(=O)(=O)O)c2)cc1S(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C18H18N4O10S2.Na/c1-31-13-5-3-11(7-15(13)33(25,26)27)9-19-21-17(23)18(24)22-20-10-12-4-6-14(32-2)16(8-12)34(28,29)30;/h3-10H,1-2H3,(H,21,23)(H,22,24)(H,25,26,27)(H,28,29,30);/q;+1/b19-9+,20-10+; |
| InChIKey | KQSTYDRPGVOJTF-HCURTGQUSA-N |
| XLogP | -3.20 |
| TPSA | 210.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.48 |
| LogP ≤ 5 | -3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|