C18H20N6Na2O8S2 — CID 131883887
CID 131883887 (PubChem CID 131883887) has the molecular formula C18H20N6Na2O8S2 and a molecular weight of 558.51 g/mol.
| Compound Name | CID 131883887 |
|---|---|
| PubChem CID | 131883887 |
| Molecular Formula | C18H20N6Na2O8S2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | — |
| SMILES | COc1ccc(C=N/N=C(N)/C(N)=N/N=Cc2ccc(OC)c(S(=O)(=O)O)c2)cc1S(=O)(=O)O.[Na].[Na] |
| InChI | InChI=1S/C18H20N6O8S2.2Na/c1-31-13-5-3-11(7-15(13)33(25,26)27)9-21-23-17(19)18(20)24-22-10-12-4-6-14(32-2)16(8-12)34(28,29)30;;/h3-10H,1-2H3,(H2,19,23)(H2,20,24)(H,25,26,27)(H,28,29,30);; |
| InChIKey | ZVKZSVHYIIPFPL-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 228.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|