C16H16N6O8S2 — CID 135422044
5-[(Z)-[(E)-[(2Z)-1,2-diamino-2-[(Z)-(4-hydroxy-3-sulfophenyl)methylidenehydrazinylidene]ethylidene]hydrazinylidene]methyl]-2-hydroxybenzenesulfonic acid (PubChem CID 135422044) has the molecular formula C16H16N6O8S2 and a molecular weight of 484.47 g/mol. Its IUPAC name is 5-[(Z)-[(E)-[(2Z)-1,2-diamino-2-[(Z)-(4-hydroxy-3-sulfophenyl)methylidenehydrazinylidene]ethylidene]hydrazinylidene]methyl]-2-hydroxybenzenesulfonic acid.
| Compound Name | 5-[(Z)-[(E)-[(2Z)-1,2-diamino-2-[(Z)-(4-hydroxy-3-sulfophenyl)methylidenehydrazinylidene]ethylidene]hydrazinylidene]methyl]-2-hydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 135422044 |
| Molecular Formula | C16H16N6O8S2 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 5-[(Z)-[(E)-[(2Z)-1,2-diamino-2-[(Z)-(4-hydroxy-3-sulfophenyl)methylidenehydrazinylidene]ethylidene]hydrazinylidene]methyl]-2-hydroxybenzenesulfonic acid |
| SMILES | NC(=N\N=C/c1ccc(O)c(S(=O)(=O)O)c1)/C(N)=N\N=C/c1ccc(O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C16H16N6O8S2/c17-15(21-19-7-9-1-3-11(23)13(5-9)31(25,26)27)16(18)22-20-8-10-2-4-12(24)14(6-10)32(28,29)30/h1-8,23-24H,(H2,17,21)(H2,18,22)(H,25,26,27)(H,28,29,30)/b19-7-,20-8- |
| InChIKey | MINBCDKYDQCJNX-DWVBSFERSA-N |
| XLogP | -0.33 |
| TPSA | 250.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|