C9H12N4O — CID 143815352
2-[(Z)-(4-hydroxy-3-methylphenyl)methylideneamino]guanidine (PubChem CID 143815352) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-[(Z)-(4-hydroxy-3-methylphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(Z)-(4-hydroxy-3-methylphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 143815352 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 2-[(Z)-(4-hydroxy-3-methylphenyl)methylideneamino]guanidine |
| SMILES | Cc1cc(/C=N\N=C(N)N)ccc1O |
| InChI | InChI=1S/C9H12N4O/c1-6-4-7(2-3-8(6)14)5-12-13-9(10)11/h2-5,14H,1H3,(H4,10,11,13)/b12-5- |
| InChIKey | UBSSBFBRAOSZEH-XGICHPGQSA-N |
| XLogP | 0.31 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|