C10H14N4 — CID 72725816
2-[(2,6-dimethylphenyl)methylideneamino]guanidine (PubChem CID 72725816) has the molecular formula C10H14N4 and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-[(2,6-dimethylphenyl)methylideneamino]guanidine.
| Compound Name | 2-[(2,6-dimethylphenyl)methylideneamino]guanidine |
|---|---|
| PubChem CID | 72725816 |
| Molecular Formula | C10H14N4 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 2-[(2,6-dimethylphenyl)methylideneamino]guanidine |
| SMILES | Cc1cccc(C)c1C=NN=C(N)N |
| InChI | InChI=1S/C10H14N4/c1-7-4-3-5-8(2)9(7)6-13-14-10(11)12/h3-6H,1-2H3,(H4,11,12,14) |
| InChIKey | WIPHQWUEUPJSRH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|