C8H10BFN4O2 — CID 168592502
[2-[(diaminomethylidenehydrazinylidene)methyl]-3-fluorophenyl]boronic acid (PubChem CID 168592502) has the molecular formula C8H10BFN4O2 and a molecular weight of 224.00 g/mol. Its IUPAC name is [2-[(diaminomethylidenehydrazinylidene)methyl]-3-fluorophenyl]boronic acid.
| Compound Name | [2-[(diaminomethylidenehydrazinylidene)methyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 168592502 |
| Molecular Formula | C8H10BFN4O2 |
| Molecular Weight | 224.00 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | [2-[(diaminomethylidenehydrazinylidene)methyl]-3-fluorophenyl]boronic acid |
| SMILES | NC(N)=NN=Cc1c(F)cccc1B(O)O |
| InChI | InChI=1S/C8H10BFN4O2/c10-7-3-1-2-6(9(15)16)5(7)4-13-14-8(11)12/h1-4,15-16H,(H4,11,12,14) |
| InChIKey | KDYOYALOINBQMD-UHFFFAOYSA-N |
| XLogP | -1.89 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.00 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|