C9H10FN3S — CID 6850944
methyl N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate (PubChem CID 6850944) has the molecular formula C9H10FN3S and a molecular weight of 211.27 g/mol. Its IUPAC name is methyl N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate.
| Compound Name | methyl N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 6850944 |
| Molecular Formula | C9H10FN3S |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | methyl N'-[(Z)-(2-fluorophenyl)methylideneamino]carbamimidothioate |
| SMILES | CSC(N)=N/N=C\c1ccccc1F |
| InChI | InChI=1S/C9H10FN3S/c1-14-9(11)13-12-6-7-4-2-3-5-8(7)10/h2-6H,1H3,(H2,11,13)/b12-6- |
| InChIKey | GOCLZQPWZWAKOE-SDQBBNPISA-N |
| XLogP | 1.84 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|