C9H9Cl2N3O2S — CID 136787213
methyl N'-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]carbamimidothioate (PubChem CID 136787213) has the molecular formula C9H9Cl2N3O2S and a molecular weight of 294.16 g/mol. Its IUPAC name is methyl N'-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]carbamimidothioate.
| Compound Name | methyl N'-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 136787213 |
| Molecular Formula | C9H9Cl2N3O2S |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | methyl N'-[(Z)-(3,5-dichloro-2,4-dihydroxyphenyl)methylideneamino]carbamimidothioate |
| SMILES | CS/C(N)=N/N=C\c1cc(Cl)c(O)c(Cl)c1O |
| InChI | InChI=1S/C9H9Cl2N3O2S/c1-17-9(12)14-13-3-4-2-5(10)8(16)6(11)7(4)15/h2-3,15-16H,1H3,(H2,12,14)/b13-3- |
| InChIKey | OLMPQNQOZRTZAR-DXNYSGJVSA-N |
| XLogP | 2.42 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|