C10H14IN3O2S — CID 135412245
methyl N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;hydroiodide (PubChem CID 135412245) has the molecular formula C10H14IN3O2S and a molecular weight of 367.21 g/mol. Its IUPAC name is methyl N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 135412245 |
| Molecular Formula | C10H14IN3O2S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | methyl N'-[(E)-(4-hydroxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;hydroiodide |
| SMILES | COc1cc(/C=N/N=C(\N)SC)ccc1O.I |
| InChI | InChI=1S/C10H13N3O2S.HI/c1-15-9-5-7(3-4-8(9)14)6-12-13-10(11)16-2;/h3-6,14H,1-2H3,(H2,11,13);1H/b12-6+; |
| InChIKey | GBOMZOMMJOKFPC-WXIWBVQFSA-N |
| XLogP | 2.03 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|