C12H18IN3O2S — CID 172988173
methyl N'-[(E)-(4-ethoxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;hydroiodide (PubChem CID 172988173) has the molecular formula C12H18IN3O2S and a molecular weight of 395.27 g/mol. Its IUPAC name is methyl N'-[(E)-(4-ethoxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;hydroiodide.
| Compound Name | methyl N'-[(E)-(4-ethoxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;hydroiodide |
|---|---|
| PubChem CID | 172988173 |
| Molecular Formula | C12H18IN3O2S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | methyl N'-[(E)-(4-ethoxy-3-methoxyphenyl)methylideneamino]carbamimidothioate;hydroiodide |
| SMILES | CCOc1ccc(/C=N/N=C(N)SC)cc1OC.I |
| InChI | InChI=1S/C12H17N3O2S.HI/c1-4-17-10-6-5-9(7-11(10)16-2)8-14-15-12(13)18-3;/h5-8H,4H2,1-3H3,(H2,13,15);1H/b14-8+; |
| InChIKey | RXOWPZJCGGJJFA-XHIXCECLSA-N |
| XLogP | 2.72 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|