C17H17Cl2N3O2S — CID 110510323
methyl N'-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]carbamimidothioate (PubChem CID 110510323) has the molecular formula C17H17Cl2N3O2S and a molecular weight of 398.32 g/mol. Its IUPAC name is methyl N'-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]carbamimidothioate.
| Compound Name | methyl N'-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]carbamimidothioate |
|---|---|
| PubChem CID | 110510323 |
| Molecular Formula | C17H17Cl2N3O2S |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | methyl N'-[(Z)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]carbamimidothioate |
| SMILES | COc1cc(/C=N\N=C(/N)SC)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H17Cl2N3O2S/c1-23-16-7-11(9-21-22-17(20)25-2)3-6-15(16)24-10-12-4-5-13(18)8-14(12)19/h3-9H,10H2,1-2H3,(H2,20,22)/b21-9- |
| InChIKey | UONDYSDFZQTOMS-NKVSQWTQSA-N |
| XLogP | 4.59 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|